C28H22N8O6S — CID 130311482
8-[[3-methyl-4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-5-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 130311482) has the molecular formula C28H22N8O6S and a molecular weight of 598.60 g/mol. Its IUPAC name is 8-[[3-methyl-4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-5-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[[3-methyl-4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-5-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 130311482 |
| Molecular Formula | C28H22N8O6S |
| Molecular Weight | 598.60 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 8-[[3-methyl-4-[(4-methylphenyl)diazenyl]phenyl]diazenyl]-5-[(2,4,6-trioxo-1,3-diazinan-5-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/C4C(=O)NC(=O)NC4=O)c4ccc(S(=O)(=O)O)cc34)cc2C)cc1 |
| InChI | InChI=1S/C28H22N8O6S/c1-15-3-5-17(6-4-15)31-33-22-10-7-18(13-16(22)2)32-34-24-12-11-23(20-9-8-19(14-21(20)24)43(40,41)42)35-36-25-26(37)29-28(39)30-27(25)38/h3-14,25H,1-2H3,(H,40,41,42)(H2,29,30,37,38,39)/b33-31+,34-32+,36-35+ |
| InChIKey | KYGZOTHULOUAKW-YLACRTQPSA-N |
| XLogP | 6.35 |
| TPSA | 203.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|