C30H23N5O8S2 — CID 143586591
8-[[4-[(4-hydroxy-2-methylphenyl)diazenyl]benzoyl]amino]-5-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 143586591) has the molecular formula C30H23N5O8S2 and a molecular weight of 645.68 g/mol. Its IUPAC name is 8-[[4-[(4-hydroxy-2-methylphenyl)diazenyl]benzoyl]amino]-5-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[[4-[(4-hydroxy-2-methylphenyl)diazenyl]benzoyl]amino]-5-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 143586591 |
| Molecular Formula | C30H23N5O8S2 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | 8-[[4-[(4-hydroxy-2-methylphenyl)diazenyl]benzoyl]amino]-5-[(4-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(O)ccc1/N=N/c1ccc(C(=O)Nc2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)c3ccc(S(=O)(=O)O)cc23)cc1 |
| InChI | InChI=1S/C30H23N5O8S2/c1-18-16-22(36)8-13-27(18)34-32-20-4-2-19(3-5-20)30(37)31-28-14-15-29(25-12-11-24(17-26(25)28)45(41,42)43)35-33-21-6-9-23(10-7-21)44(38,39)40/h2-17,36H,1H3,(H,31,37)(H,38,39,40)(H,41,42,43)/b34-32+,35-33+ |
| InChIKey | JCSFJSOMVMCMDG-XUXOKTBYSA-N |
| XLogP | 7.43 |
| TPSA | 207.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|