C39H30N8O13S2 — CID 135449663
2-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-5-[[4-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-3-sulfophenyl]carbamoylamino]benzenesulfonic acid (PubChem CID 135449663) has the molecular formula C39H30N8O13S2 and a molecular weight of 882.85 g/mol. Its IUPAC name is 2-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-5-[[4-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-3-sulfophenyl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 2-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-5-[[4-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-3-sulfophenyl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 135449663 |
| Molecular Formula | C39H30N8O13S2 |
| Molecular Weight | 882.85 g/mol |
| Exact Mass | 882.14 |
| IUPAC Name | 2-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-5-[[4-[[4-[(2,4-dihydroxyphenyl)diazenyl]benzoyl]amino]-3-sulfophenyl]carbamoylamino]benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(NC(=O)c2ccc(/N=N/c3ccc(O)cc3O)cc2)c(S(=O)(=O)O)c1)Nc1ccc(NC(=O)c2ccc(/N=N/c3ccc(O)cc3O)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C39H30N8O13S2/c48-27-11-15-29(33(50)19-27)46-44-23-5-1-21(2-6-23)37(52)42-31-13-9-25(17-35(31)61(55,56)57)40-39(54)41-26-10-14-32(36(18-26)62(58,59)60)43-38(53)22-3-7-24(8-4-22)45-47-30-16-12-28(49)20-34(30)51/h1-20,48-51H,(H,42,52)(H,43,53)(H2,40,41,54)(H,55,56,57)(H,58,59,60)/b46-44+,47-45+ |
| InChIKey | GRMHYWMHLDHJQF-NFAUJPPVSA-N |
| XLogP | 7.98 |
| TPSA | 338.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.85 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|