C35H27N9O13S3 — CID 142625509
4-[[8-amino-7-[[4-[4-[(4-amino-2-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid (PubChem CID 142625509) has the molecular formula C35H27N9O13S3 and a molecular weight of 877.85 g/mol. Its IUPAC name is 4-[[8-amino-7-[[4-[4-[(4-amino-2-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid.
| Compound Name | 4-[[8-amino-7-[[4-[4-[(4-amino-2-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 142625509 |
| Molecular Formula | C35H27N9O13S3 |
| Molecular Weight | 877.85 g/mol |
| Exact Mass | 877.09 |
| IUPAC Name | 4-[[8-amino-7-[[4-[4-[(4-amino-2-hydroxyphenyl)diazenyl]anilino]-3-sulfophenyl]diazenyl]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(Nc3ccc(/N=N/c4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)c(/N=N/c6ccc(C(=O)O)cc6)c(O)c5c4N)cc3S(=O)(=O)O)cc2)c(O)c1 |
| InChI | InChI=1S/C35H27N9O13S3/c36-19-3-11-24(26(45)15-19)42-39-22-8-6-20(7-9-22)38-25-12-10-23(16-27(25)58(49,50)51)41-43-32-28(59(52,53)54)13-18-14-29(60(55,56)57)33(34(46)30(18)31(32)37)44-40-21-4-1-17(2-5-21)35(47)48/h1-16,38,45-46H,36-37H2,(H,47,48)(H,49,50,51)(H,52,53,54)(H,55,56,57)/b42-39+,43-41+,44-40+ |
| InChIKey | BNCMUTZQJFDTRM-AUVAVNHBSA-N |
| XLogP | 7.84 |
| TPSA | 379.10 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.85 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|