C27H23N5O6S — CID 143586527
4-[[4-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]benzoyl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid (PubChem CID 143586527) has the molecular formula C27H23N5O6S and a molecular weight of 545.58 g/mol. Its IUPAC name is 4-[[4-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]benzoyl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[[4-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]benzoyl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143586527 |
| Molecular Formula | C27H23N5O6S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-[[4-[[4-[(4-hydroxy-3-methylphenyl)diazenyl]benzoyl]amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1NC(=O)c1ccc(/N=N/c2ccc(O)c(C)c2)cc1 |
| InChI | InChI=1S/C27H23N5O6S/c1-17-15-21(10-14-25(17)33)31-29-19-5-3-18(4-6-19)27(34)28-24-13-9-22(16-26(24)38-2)32-30-20-7-11-23(12-8-20)39(35,36)37/h3-16,33H,1-2H3,(H,28,34)(H,35,36,37)/b31-29+,32-30+ |
| InChIKey | RXCYMAJSHJGPTP-JWTBXLROSA-N |
| XLogP | 7.04 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|