C27H26N6O9S2 — CID 21339241
3-[[3-methoxy-4-[[2-methoxy-4-[[3-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid (PubChem CID 21339241) has the molecular formula C27H26N6O9S2 and a molecular weight of 642.67 g/mol. Its IUPAC name is 3-[[3-methoxy-4-[[2-methoxy-4-[[3-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[3-methoxy-4-[[2-methoxy-4-[[3-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21339241 |
| Molecular Formula | C27H26N6O9S2 |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | 3-[[3-methoxy-4-[[2-methoxy-4-[[3-(trihydroxy-λ4-sulfanyl)phenyl]diazenyl]phenyl]carbamoylamino]phenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(O)(O)O)c2)ccc1NC(=O)Nc1ccc(/N=N/c2cccc(S(=O)(=O)O)c2)cc1OC |
| InChI | InChI=1S/C27H26N6O9S2/c1-41-25-15-19(32-30-17-5-3-7-21(13-17)43(35,36)37)9-11-23(25)28-27(34)29-24-12-10-20(16-26(24)42-2)33-31-18-6-4-8-22(14-18)44(38,39)40/h3-16,35-37H,1-2H3,(H2,28,29,34)(H,38,39,40)/b32-30+,33-31+ |
| InChIKey | IILJUEJWJMMVPO-RRPBDJRISA-N |
| XLogP | 8.01 |
| TPSA | 224.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|