C21H21N4O8PS — CID 89075738
3-[[4-[[3-[hydroxy(methoxy)phosphoryl]phenyl]carbamoylamino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid (PubChem CID 89075738) has the molecular formula C21H21N4O8PS and a molecular weight of 520.46 g/mol. Its IUPAC name is 3-[[4-[[3-[hydroxy(methoxy)phosphoryl]phenyl]carbamoylamino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[[3-[hydroxy(methoxy)phosphoryl]phenyl]carbamoylamino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89075738 |
| Molecular Formula | C21H21N4O8PS |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 3-[[4-[[3-[hydroxy(methoxy)phosphoryl]phenyl]carbamoylamino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1NC(=O)Nc1cccc(P(=O)(O)OC)c1 |
| InChI | InChI=1S/C21H21N4O8PS/c1-32-20-13-16(25-24-15-6-4-8-18(12-15)35(29,30)31)9-10-19(20)23-21(26)22-14-5-3-7-17(11-14)34(27,28)33-2/h3-13H,1-2H3,(H,27,28)(H2,22,23,26)(H,29,30,31)/b25-24+ |
| InChIKey | LKEQPVAKPRLQLP-OCOZRVBESA-N |
| XLogP | 4.46 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|