C20H18N4O5S — CID 143586570
3-[[4-[(4-aminobenzoyl)amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid (PubChem CID 143586570) has the molecular formula C20H18N4O5S and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-[[4-[(4-aminobenzoyl)amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[(4-aminobenzoyl)amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 143586570 |
| Molecular Formula | C20H18N4O5S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-[[4-[(4-aminobenzoyl)amino]-3-methoxyphenyl]diazenyl]benzenesulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H18N4O5S/c1-29-19-12-16(24-23-15-3-2-4-17(11-15)30(26,27)28)9-10-18(19)22-20(25)13-5-7-14(21)8-6-13/h2-12H,21H2,1H3,(H,22,25)(H,26,27,28)/b24-23+ |
| InChIKey | WVDPKPWNMKMOQZ-WCWDXBQESA-N |
| XLogP | 4.19 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|