C27H22Li2N6O9S2 — CID 136863325
dilithium;3-[[3-methoxy-4-[[[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-oxidomethylidene]amino]phenyl]diazenyl]benzenesulfonate (PubChem CID 136863325) has the molecular formula C27H22Li2N6O9S2 and a molecular weight of 652.52 g/mol. Its IUPAC name is dilithium;3-[[3-methoxy-4-[[[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-oxidomethylidene]amino]phenyl]diazenyl]benzenesulfonate.
| Compound Name | dilithium;3-[[3-methoxy-4-[[[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-oxidomethylidene]amino]phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 136863325 |
| Molecular Formula | C27H22Li2N6O9S2 |
| Molecular Weight | 652.52 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | dilithium;3-[[3-methoxy-4-[[[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-oxidomethylidene]amino]phenyl]diazenyl]benzenesulfonate |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)[O-])c2)ccc1/N=C(\[O-])Nc1ccc(/N=N/c2cccc(S(=O)(=O)O)c2)cc1OC.[Li+].[Li+] |
| InChI | InChI=1S/C27H24N6O9S2.2Li/c1-41-25-15-19(32-30-17-5-3-7-21(13-17)43(35,36)37)9-11-23(25)28-27(34)29-24-12-10-20(16-26(24)42-2)33-31-18-6-4-8-22(14-18)44(38,39)40;;/h3-16H,1-2H3,(H2,28,29,34)(H,35,36,37)(H,38,39,40);;/q;2*+1/p-2/b32-30+,33-31+;; |
| InChIKey | GPLFFGMCJVNAMA-WKLYGGTQSA-L |
| XLogP | -0.85 |
| TPSA | 226.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.52 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|