C24H25LiN4O6S — CID 23668625
lithium 3-[[4-[[4-(2-hydroxybutoxy)phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]benzenesulfonate (PubChem CID 23668625) has the molecular formula C24H25LiN4O6S and a molecular weight of 504.49 g/mol. Its IUPAC name is lithium 3-[[4-[[4-(2-hydroxybutoxy)phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]benzenesulfonate.
| Compound Name | lithium 3-[[4-[[4-(2-hydroxybutoxy)phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 23668625 |
| Molecular Formula | C24H25LiN4O6S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | lithium 3-[[4-[[4-(2-hydroxybutoxy)phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]benzenesulfonate |
| SMILES | CCC(O)COc1ccc(/N=N/c2cc(C)c(/N=N/c3cccc(S(=O)(=O)[O-])c3)cc2OC)cc1.[Li+] |
| InChI | InChI=1S/C24H26N4O6S.Li/c1-4-19(29)15-34-20-10-8-17(9-11-20)25-28-23-12-16(2)22(14-24(23)33-3)27-26-18-6-5-7-21(13-18)35(30,31)32;/h5-14,19,29H,4,15H2,1-3H3,(H,30,31,32);/q;+1/p-1/b27-26+,28-25+; |
| InChIKey | BINUNLRKNMJFHG-CSISOKLTSA-M |
| XLogP | 2.89 |
| TPSA | 145.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|