C28H24N8O7S2 — CID 135608337
6-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135608337) has the molecular formula C28H24N8O7S2 and a molecular weight of 648.68 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 6-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135608337 |
| Molecular Formula | C28H24N8O7S2 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.12 |
| IUPAC Name | 6-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(S(=O)(=O)Nc3ncccn3)cc2)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2ccc(N)cc2c1O |
| InChI | InChI=1S/C28H24N8O7S2/c1-16-12-23(34-35-26-25(45(40,41)42)13-17-4-5-18(29)14-21(17)27(26)37)24(43-2)15-22(16)33-32-19-6-8-20(9-7-19)44(38,39)36-28-30-10-3-11-31-28/h3-15,37H,29H2,1-2H3,(H,30,31,36)(H,40,41,42)/b33-32+,35-34+ |
| InChIKey | PBHFFVYHKWZTFI-VPHDGDOJSA-N |
| XLogP | 6.11 |
| TPSA | 231.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|