C15H14ClNO6S — CID 139945414
3-chloro-4-[(2,6-dimethoxybenzoyl)amino]benzenesulfonic acid (PubChem CID 139945414) has the molecular formula C15H14ClNO6S and a molecular weight of 371.80 g/mol. Its IUPAC name is 3-chloro-4-[(2,6-dimethoxybenzoyl)amino]benzenesulfonic acid.
| Compound Name | 3-chloro-4-[(2,6-dimethoxybenzoyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 139945414 |
| Molecular Formula | C15H14ClNO6S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 3-chloro-4-[(2,6-dimethoxybenzoyl)amino]benzenesulfonic acid |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C15H14ClNO6S/c1-22-12-4-3-5-13(23-2)14(12)15(18)17-11-7-6-9(8-10(11)16)24(19,20)21/h3-8H,1-2H3,(H,17,18)(H,19,20,21) |
| InChIKey | YDDKNTDGDOIKQB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|