C23H31NO5S — CID 139945373
3-methoxy-4-[[2,4,6-tri(propan-2-yl)benzoyl]amino]benzenesulfonic acid (PubChem CID 139945373) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-methoxy-4-[[2,4,6-tri(propan-2-yl)benzoyl]amino]benzenesulfonic acid.
| Compound Name | 3-methoxy-4-[[2,4,6-tri(propan-2-yl)benzoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 139945373 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-methoxy-4-[[2,4,6-tri(propan-2-yl)benzoyl]amino]benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)ccc1NC(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C23H31NO5S/c1-13(2)16-10-18(14(3)4)22(19(11-16)15(5)6)23(25)24-20-9-8-17(30(26,27)28)12-21(20)29-7/h8-15H,1-7H3,(H,24,25)(H,26,27,28) |
| InChIKey | VZXKRXMCCDWLJV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|