C22H27NO5 — CID 4797555
2-[[2,4-di(propan-2-yl)benzoyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 4797555) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[[2,4-di(propan-2-yl)benzoyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[[2,4-di(propan-2-yl)benzoyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 4797555 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[[2,4-di(propan-2-yl)benzoyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(NC(=O)c2ccc(C(C)C)cc2C(C)C)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C22H27NO5/c1-12(2)14-7-8-15(16(9-14)13(3)4)21(24)23-18-11-20(28-6)19(27-5)10-17(18)22(25)26/h7-13H,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | BSNOJCUBDHBJFY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |