C21H14ClNO4S — CID 139945425
4-(anthracene-9-carbonylamino)-3-chlorobenzenesulfonic acid (PubChem CID 139945425) has the molecular formula C21H14ClNO4S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-(anthracene-9-carbonylamino)-3-chlorobenzenesulfonic acid.
| Compound Name | 4-(anthracene-9-carbonylamino)-3-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 139945425 |
| Molecular Formula | C21H14ClNO4S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 4-(anthracene-9-carbonylamino)-3-chlorobenzenesulfonic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)O)cc1Cl)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H14ClNO4S/c22-18-12-15(28(25,26)27)9-10-19(18)23-21(24)20-16-7-3-1-5-13(16)11-14-6-2-4-8-17(14)20/h1-12H,(H,23,24)(H,25,26,27) |
| InChIKey | OIAVFYWNXSBYPT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|