C13H10ClIN2O3S — CID 43246729
N-(2-chloro-4-sulfamoylphenyl)-2-iodobenzamide (PubChem CID 43246729) has the molecular formula C13H10ClIN2O3S and a molecular weight of 436.66 g/mol. Its IUPAC name is N-(2-chloro-4-sulfamoylphenyl)-2-iodobenzamide.
| Compound Name | N-(2-chloro-4-sulfamoylphenyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 43246729 |
| Molecular Formula | C13H10ClIN2O3S |
| Molecular Weight | 436.66 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | N-(2-chloro-4-sulfamoylphenyl)-2-iodobenzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccccc2I)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClIN2O3S/c14-10-7-8(21(16,19)20)5-6-12(10)17-13(18)9-3-1-2-4-11(9)15/h1-7H,(H,17,18)(H2,16,19,20) |
| InChIKey | FSOHCUBLBCALIO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|