C14H13ClN2O4S — CID 21491240
4-[(3-amino-4-methylbenzoyl)amino]-3-chlorobenzenesulfonic acid (PubChem CID 21491240) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is 4-[(3-amino-4-methylbenzoyl)amino]-3-chlorobenzenesulfonic acid.
| Compound Name | 4-[(3-amino-4-methylbenzoyl)amino]-3-chlorobenzenesulfonic acid |
|---|---|
| PubChem CID | 21491240 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-[(3-amino-4-methylbenzoyl)amino]-3-chlorobenzenesulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)cc2Cl)cc1N |
| InChI | InChI=1S/C14H13ClN2O4S/c1-8-2-3-9(6-12(8)16)14(18)17-13-5-4-10(7-11(13)15)22(19,20)21/h2-7H,16H2,1H3,(H,17,18)(H,19,20,21) |
| InChIKey | MZEICVQJQXEYKE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|