C25H23N3O12S4 — CID 23332438
8-[[3-[(3-amino-4-methylbenzoyl)amino]-4-methylphenyl]sulfonylamino]naphthalene-1,3,5-trisulfonic acid (PubChem CID 23332438) has the molecular formula C25H23N3O12S4 and a molecular weight of 685.74 g/mol. Its IUPAC name is 8-[[3-[(3-amino-4-methylbenzoyl)amino]-4-methylphenyl]sulfonylamino]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 8-[[3-[(3-amino-4-methylbenzoyl)amino]-4-methylphenyl]sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 23332438 |
| Molecular Formula | C25H23N3O12S4 |
| Molecular Weight | 685.74 g/mol |
| Exact Mass | 685.02 |
| IUPAC Name | 8-[[3-[(3-amino-4-methylbenzoyl)amino]-4-methylphenyl]sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
| SMILES | Cc1ccc(C(=O)Nc2cc(S(=O)(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2C)cc1N |
| InChI | InChI=1S/C25H23N3O12S4/c1-13-3-5-15(9-19(13)26)25(29)27-21-11-16(6-4-14(21)2)41(30,31)28-20-7-8-22(43(35,36)37)18-10-17(42(32,33)34)12-23(24(18)20)44(38,39)40/h3-12,28H,26H2,1-2H3,(H,27,29)(H,32,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | VIWFVCGXKBYVPO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 264.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|