C19H18N2O11S3 — CID 11498149
8-[[3-amino-4-(methoxymethyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid (PubChem CID 11498149) has the molecular formula C19H18N2O11S3 and a molecular weight of 546.56 g/mol. Its IUPAC name is 8-[[3-amino-4-(methoxymethyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 8-[[3-amino-4-(methoxymethyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 11498149 |
| Molecular Formula | C19H18N2O11S3 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | 8-[[3-amino-4-(methoxymethyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid |
| SMILES | COCc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1N |
| InChI | InChI=1S/C19H18N2O11S3/c1-32-9-11-3-2-10(6-14(11)20)19(22)21-15-4-5-16(34(26,27)28)13-7-12(33(23,24)25)8-17(18(13)15)35(29,30)31/h2-8H,9,20H2,1H3,(H,21,22)(H,23,24,25)(H,26,27,28)(H,29,30,31) |
| InChIKey | RWSFTPHNFWXCPP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 227.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|