C23H18N2O10S3 — CID 122674674
8-[[2-(4-aminophenyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid (PubChem CID 122674674) has the molecular formula C23H18N2O10S3 and a molecular weight of 578.60 g/mol. Its IUPAC name is 8-[[2-(4-aminophenyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 8-[[2-(4-aminophenyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 122674674 |
| Molecular Formula | C23H18N2O10S3 |
| Molecular Weight | 578.60 g/mol |
| Exact Mass | 578.01 |
| IUPAC Name | 8-[[2-(4-aminophenyl)benzoyl]amino]naphthalene-1,3,5-trisulfonic acid |
| SMILES | Nc1ccc(-c2ccccc2C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1 |
| InChI | InChI=1S/C23H18N2O10S3/c24-14-7-5-13(6-8-14)16-3-1-2-4-17(16)23(26)25-19-9-10-20(37(30,31)32)18-11-15(36(27,28)29)12-21(22(18)19)38(33,34)35/h1-12H,24H2,(H,25,26)(H,27,28,29)(H,30,31,32)(H,33,34,35) |
| InChIKey | PKJMUUVTSIEYHI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 218.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.60 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|