C17H14N2O10S3 — CID 23335888
4-[(4-amino-2-sulfobenzoyl)amino]naphthalene-1,6-disulfonic acid (PubChem CID 23335888) has the molecular formula C17H14N2O10S3 and a molecular weight of 502.50 g/mol. Its IUPAC name is 4-[(4-amino-2-sulfobenzoyl)amino]naphthalene-1,6-disulfonic acid.
| Compound Name | 4-[(4-amino-2-sulfobenzoyl)amino]naphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 23335888 |
| Molecular Formula | C17H14N2O10S3 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 4-[(4-amino-2-sulfobenzoyl)amino]naphthalene-1,6-disulfonic acid |
| SMILES | Nc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3ccc(S(=O)(=O)O)cc23)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H14N2O10S3/c18-9-1-3-12(16(7-9)32(27,28)29)17(20)19-14-5-6-15(31(24,25)26)11-4-2-10(8-13(11)14)30(21,22)23/h1-8H,18H2,(H,19,20)(H,21,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | PSGGVWGOHNRTRV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 218.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|