C17H14N2O8S2 — CID 3018000
4-[(3-aminobenzoyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 3018000) has the molecular formula C17H14N2O8S2 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-[(3-aminobenzoyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 4-[(3-aminobenzoyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 3018000 |
| Molecular Formula | C17H14N2O8S2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 4-[(3-aminobenzoyl)amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | Nc1cccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(O)c23)c1 |
| InChI | InChI=1S/C17H14N2O8S2/c18-10-3-1-2-9(6-10)17(21)19-13-4-5-15(29(25,26)27)12-7-11(28(22,23)24)8-14(20)16(12)13/h1-8,20H,18H2,(H,19,21)(H,22,23,24)(H,25,26,27) |
| InChIKey | GXAGGOUUTLWTGU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 184.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|