C17H14N2O5S — CID 23348122
8-[(3-aminobenzoyl)amino]-3-hydroxynaphthalene-1-sulfonic acid (PubChem CID 23348122) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is 8-[(3-aminobenzoyl)amino]-3-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 8-[(3-aminobenzoyl)amino]-3-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 23348122 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 8-[(3-aminobenzoyl)amino]-3-hydroxynaphthalene-1-sulfonic acid |
| SMILES | Nc1cccc(C(=O)Nc2cccc3cc(O)cc(S(=O)(=O)O)c23)c1 |
| InChI | InChI=1S/C17H14N2O5S/c18-12-5-1-4-11(7-12)17(21)19-14-6-2-3-10-8-13(20)9-15(16(10)14)25(22,23)24/h1-9,20H,18H2,(H,19,21)(H,22,23,24) |
| InChIKey | PEYSUGZUATXRKY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|