C30H23N3O5S — CID 129275749
8-[[4-[4-[(4-aminobenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid (PubChem CID 129275749) has the molecular formula C30H23N3O5S and a molecular weight of 537.60 g/mol. Its IUPAC name is 8-[[4-[4-[(4-aminobenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid.
| Compound Name | 8-[[4-[4-[(4-aminobenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 129275749 |
| Molecular Formula | C30H23N3O5S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 8-[[4-[4-[(4-aminobenzoyl)amino]phenyl]benzoyl]amino]naphthalene-1-sulfonic acid |
| SMILES | Nc1ccc(C(=O)Nc2ccc(-c3ccc(C(=O)Nc4cccc5cccc(S(=O)(=O)O)c45)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H23N3O5S/c31-24-15-11-23(12-16-24)29(34)32-25-17-13-20(14-18-25)19-7-9-22(10-8-19)30(35)33-26-5-1-3-21-4-2-6-27(28(21)26)39(36,37)38/h1-18H,31H2,(H,32,34)(H,33,35)(H,36,37,38) |
| InChIKey | VDYBAGIVJNSWIL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|