C34H24N2O7S — CID 170524161
4-hydroxy-5-[[4-[4-[(8-hydroxynaphthalen-1-yl)carbamoyl]phenyl]benzoyl]amino]naphthalene-2-sulfonic acid (PubChem CID 170524161) has the molecular formula C34H24N2O7S and a molecular weight of 604.64 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-[4-[(8-hydroxynaphthalen-1-yl)carbamoyl]phenyl]benzoyl]amino]naphthalene-2-sulfonic acid.
| Compound Name | 4-hydroxy-5-[[4-[4-[(8-hydroxynaphthalen-1-yl)carbamoyl]phenyl]benzoyl]amino]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 170524161 |
| Molecular Formula | C34H24N2O7S |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 4-hydroxy-5-[[4-[4-[(8-hydroxynaphthalen-1-yl)carbamoyl]phenyl]benzoyl]amino]naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1cccc2cccc(O)c12)c1ccc(-c2ccc(C(=O)Nc3cccc4cc(S(=O)(=O)O)cc(O)c34)cc2)cc1 |
| InChI | InChI=1S/C34H24N2O7S/c37-29-9-3-5-22-4-1-7-27(31(22)29)35-33(39)23-14-10-20(11-15-23)21-12-16-24(17-13-21)34(40)36-28-8-2-6-25-18-26(44(41,42)43)19-30(38)32(25)28/h1-19,37-38H,(H,35,39)(H,36,40)(H,41,42,43) |
| InChIKey | DQTGDIPWXIIPJK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|