C11H10N2O5S — CID 18965669
5-(carbamoylamino)-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 18965669) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is 5-(carbamoylamino)-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 5-(carbamoylamino)-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 18965669 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-(carbamoylamino)-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | NC(=O)Nc1cccc2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C11H10N2O5S/c12-11(15)13-8-3-1-2-6-4-7(19(16,17)18)5-9(14)10(6)8/h1-5,14H,(H3,12,13,15)(H,16,17,18) |
| InChIKey | HJHHZBFLRLGTRM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|