C13H10N2O4S — CID 168524341
8-[(2-cyanoacetyl)amino]naphthalene-1-sulfonic acid (PubChem CID 168524341) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is 8-[(2-cyanoacetyl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 8-[(2-cyanoacetyl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 168524341 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 8-[(2-cyanoacetyl)amino]naphthalene-1-sulfonic acid |
| SMILES | N#CCC(=O)Nc1cccc2cccc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C13H10N2O4S/c14-8-7-12(16)15-10-5-1-3-9-4-2-6-11(13(9)10)20(17,18)19/h1-6H,7H2,(H,15,16)(H,17,18,19) |
| InChIKey | DPWHQCCXCWGHPI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|