C16H19NO4S — CID 59749914
8-(2,2-dimethylbutanoylamino)naphthalene-1-sulfonic acid (PubChem CID 59749914) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 8-(2,2-dimethylbutanoylamino)naphthalene-1-sulfonic acid.
| Compound Name | 8-(2,2-dimethylbutanoylamino)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 59749914 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 8-(2,2-dimethylbutanoylamino)naphthalene-1-sulfonic acid |
| SMILES | CCC(C)(C)C(=O)Nc1cccc2cccc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C16H19NO4S/c1-4-16(2,3)15(18)17-12-9-5-7-11-8-6-10-13(14(11)12)22(19,20)21/h5-10H,4H2,1-3H3,(H,17,18)(H,19,20,21) |
| InChIKey | XMTZXMHKHOGQHW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|