C10H10N2O5S — CID 168523008
3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methylbenzenesulfonic acid (PubChem CID 168523008) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methylbenzenesulfonic acid.
| Compound Name | 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 168523008 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 3-[(2-cyanoacetyl)amino]-2-hydroxy-5-methylbenzenesulfonic acid |
| SMILES | Cc1cc(NC(=O)CC#N)c(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H10N2O5S/c1-6-4-7(12-9(13)2-3-11)10(14)8(5-6)18(15,16)17/h4-5,14H,2H2,1H3,(H,12,13)(H,15,16,17) |
| InChIKey | GKOGXFZXBQVKSD-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|