C16H13N5O2 — CID 168521196
N-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]-2-cyanoacetamide (PubChem CID 168521196) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]-2-cyanoacetamide.
| Compound Name | N-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 168521196 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[3-(benzotriazol-2-yl)-2-hydroxy-5-methylphenyl]-2-cyanoacetamide |
| SMILES | Cc1cc(NC(=O)CC#N)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C16H13N5O2/c1-10-8-13(18-15(22)6-7-17)16(23)14(9-10)21-19-11-4-2-3-5-12(11)20-21/h2-5,8-9,23H,6H2,1H3,(H,18,22) |
| InChIKey | SBRCJUAIVQLCRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|