About N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide
N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide (PubChem CID 14274283) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide.
Molecular Properties
| Compound Name | N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide |
| PubChem CID | 14274283 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccc2nn(-c3cc(C)cc(C)c3O)nc2c1 |
| InChI | InChI=1S/C18H18N4O3/c1-10-6-11(2)18(25)16(7-10)22-20-14-5-4-13(9-15(14)21-22)19-17(24)8-12(3)23/h4-7,9,25H,8H2,1-3H3,(H,19,24) |
| InChIKey | JLZDLRILEQYEQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The IUPAC name of N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide (CID 14274283) is N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide.
What is the SMILES notation for N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The canonical SMILES for N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide is CC(=O)CC(=O)Nc1ccc2nn(-c3cc(C)cc(C)c3O)nc2c1.
What is the InChIKey of N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide?
The InChIKey is JLZDLRILEQYEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-10-6-11(2)18(25)16(7-10)22-20-14-5-4-13(9-15(14)21-22)19-17(24)8-12(3)23/h4-7,9,25H,8H2,1-3H3,(H,19,24).
What are the key properties of N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide?
N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide has a molecular weight of 338.37 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-hydroxy-3,5-dimethylphenyl)benzotriazol-5-yl]-3-oxobutanamide is sourced from PubChem (CID 14274283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).