C16H18ClN3O — CID 54559127
2-(5-chlorobenzotriazol-2-yl)-4,6-dimethylphenol;ethane (PubChem CID 54559127) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-(5-chlorobenzotriazol-2-yl)-4,6-dimethylphenol;ethane.
| Compound Name | 2-(5-chlorobenzotriazol-2-yl)-4,6-dimethylphenol;ethane |
|---|---|
| PubChem CID | 54559127 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(5-chlorobenzotriazol-2-yl)-4,6-dimethylphenol;ethane |
| SMILES | CC.Cc1cc(C)c(O)c(-n2nc3ccc(Cl)cc3n2)c1 |
| InChI | InChI=1S/C14H12ClN3O.C2H6/c1-8-5-9(2)14(19)13(6-8)18-16-11-4-3-10(15)7-12(11)17-18;1-2/h3-7,19H,1-2H3;1-2H3 |
| InChIKey | ZPHDYUIBRFBMNW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |