C17H18ClN3O — CID 139026087
2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(trideuteriomethyl)phenol (PubChem CID 139026087) has the molecular formula C17H18ClN3O and a molecular weight of 318.82 g/mol. Its IUPAC name is 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(trideuteriomethyl)phenol.
| Compound Name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(trideuteriomethyl)phenol |
|---|---|
| PubChem CID | 139026087 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-(trideuteriomethyl)phenol |
| SMILES | [2H]C([2H])([2H])c1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H18ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-19-13-6-5-11(18)9-14(13)20-21/h5-9,22H,1-4H3/i1D3 |
| InChIKey | OCWYEMOEOGEQAN-FIBGUPNXSA-N |
| XLogP | 4.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |