C23H29N3O2 — CID 160836131
2-tert-butyl-4-methyl-6-(5-methylbenzotriazol-2-yl)phenol;3-methylbut-3-en-2-one (PubChem CID 160836131) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-(5-methylbenzotriazol-2-yl)phenol;3-methylbut-3-en-2-one.
| Compound Name | 2-tert-butyl-4-methyl-6-(5-methylbenzotriazol-2-yl)phenol;3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 160836131 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-(5-methylbenzotriazol-2-yl)phenol;3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(C)=O.Cc1cc(-n2nc3ccc(C)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H21N3O.C5H8O/c1-11-6-7-14-15(9-11)20-21(19-14)16-10-12(2)8-13(17(16)22)18(3,4)5;1-4(2)5(3)6/h6-10,22H,1-5H3;1H2,2-3H3 |
| InChIKey | SHKWTKCHZGHINJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|