C21H27N3OS — CID 140801651
2-tert-butyl-4-methyl-6-[5-[2-[methyl(methylidene)-λ4-sulfanyl]ethyl]benzotriazol-2-yl]phenol (PubChem CID 140801651) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[5-[2-[methyl(methylidene)-λ4-sulfanyl]ethyl]benzotriazol-2-yl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[5-[2-[methyl(methylidene)-λ4-sulfanyl]ethyl]benzotriazol-2-yl]phenol |
|---|---|
| PubChem CID | 140801651 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[5-[2-[methyl(methylidene)-λ4-sulfanyl]ethyl]benzotriazol-2-yl]phenol |
| SMILES | C=S(C)CCc1ccc2nn(-c3cc(C)cc(C(C)(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C21H27N3OS/c1-14-11-16(21(2,3)4)20(25)19(12-14)24-22-17-8-7-15(9-10-26(5)6)13-18(17)23-24/h7-8,11-13,25H,5,9-10H2,1-4,6H3 |
| InChIKey | DUCRSIIBFDZAMN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|