C35H55N3OS — CID 140801656
2-tert-butyl-4-methyl-6-[5-[9-[methylidene(octyl)-λ4-sulfanyl]nonyl]benzotriazol-2-yl]phenol (PubChem CID 140801656) has the molecular formula C35H55N3OS and a molecular weight of 565.91 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[5-[9-[methylidene(octyl)-λ4-sulfanyl]nonyl]benzotriazol-2-yl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[5-[9-[methylidene(octyl)-λ4-sulfanyl]nonyl]benzotriazol-2-yl]phenol |
|---|---|
| PubChem CID | 140801656 |
| Molecular Formula | C35H55N3OS |
| Molecular Weight | 565.91 g/mol |
| Exact Mass | 565.41 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[5-[9-[methylidene(octyl)-λ4-sulfanyl]nonyl]benzotriazol-2-yl]phenol |
| SMILES | C=S(CCCCCCCC)CCCCCCCCCc1ccc2nn(-c3cc(C)cc(C(C)(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C35H55N3OS/c1-7-8-9-10-15-18-23-40(6)24-19-16-13-11-12-14-17-20-29-21-22-31-32(27-29)37-38(36-31)33-26-28(2)25-30(34(33)39)35(3,4)5/h21-22,25-27,39H,6-20,23-24H2,1-5H3 |
| InChIKey | XGSPRVKQBSKIGF-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.91 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|