C13H10N2O5S — CID 168524118
4-[(2-cyanoacetyl)amino]-3-hydroxynaphthalene-1-sulfonic acid (PubChem CID 168524118) has the molecular formula C13H10N2O5S and a molecular weight of 306.30 g/mol. Its IUPAC name is 4-[(2-cyanoacetyl)amino]-3-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 4-[(2-cyanoacetyl)amino]-3-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 168524118 |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-[(2-cyanoacetyl)amino]-3-hydroxynaphthalene-1-sulfonic acid |
| SMILES | N#CCC(=O)Nc1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C13H10N2O5S/c14-6-5-12(17)15-13-9-4-2-1-3-8(9)11(7-10(13)16)21(18,19)20/h1-4,7,16H,5H2,(H,15,17)(H,18,19,20) |
| InChIKey | XKKDETLGBKMTCX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|