C13H12ClNO5S — CID 18877404
4-(2-chloropropanoylamino)-3-hydroxynaphthalene-1-sulfonic acid (PubChem CID 18877404) has the molecular formula C13H12ClNO5S and a molecular weight of 329.76 g/mol. Its IUPAC name is 4-(2-chloropropanoylamino)-3-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 4-(2-chloropropanoylamino)-3-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 18877404 |
| Molecular Formula | C13H12ClNO5S |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-(2-chloropropanoylamino)-3-hydroxynaphthalene-1-sulfonic acid |
| SMILES | CC(Cl)C(=O)Nc1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C13H12ClNO5S/c1-7(14)13(17)15-12-9-5-3-2-4-8(9)11(6-10(12)16)21(18,19)20/h2-7,16H,1H3,(H,15,17)(H,18,19,20) |
| InChIKey | JJFYGPHGUSKMLB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|