C15H8N4O4S — CID 168610574
3-hydroxy-4-(1,2,2-tricyanoethenylamino)naphthalene-1-sulfonic acid (PubChem CID 168610574) has the molecular formula C15H8N4O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is 3-hydroxy-4-(1,2,2-tricyanoethenylamino)naphthalene-1-sulfonic acid.
| Compound Name | 3-hydroxy-4-(1,2,2-tricyanoethenylamino)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 168610574 |
| Molecular Formula | C15H8N4O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-hydroxy-4-(1,2,2-tricyanoethenylamino)naphthalene-1-sulfonic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C15H8N4O4S/c16-6-9(7-17)12(8-18)19-15-11-4-2-1-3-10(11)14(5-13(15)20)24(21,22)23/h1-5,19-20H,(H,21,22,23) |
| InChIKey | CGFHNZURBGCNPX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|