C15H12N4O3S — CID 168609430
3-(1,2,2-tricyanoethenylamino)-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 168609430) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is 3-(1,2,2-tricyanoethenylamino)-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 3-(1,2,2-tricyanoethenylamino)-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 168609430 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-(1,2,2-tricyanoethenylamino)-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc2c(cc1S(=O)(=O)O)CCCC2 |
| InChI | InChI=1S/C15H12N4O3S/c16-7-12(8-17)14(9-18)19-13-5-10-3-1-2-4-11(10)6-15(13)23(20,21)22/h5-6,19H,1-4H2,(H,20,21,22) |
| InChIKey | CZRDNCVIYBYQJR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|