C23H27N5O2S — CID 168609371
N,N-dicyclohexyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide (PubChem CID 168609371) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide.
| Compound Name | N,N-dicyclohexyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 168609371 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N,N-dicyclohexyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccccc1S(=O)(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H27N5O2S/c24-15-18(16-25)22(17-26)27-21-13-7-8-14-23(21)31(29,30)28(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h7-8,13-14,19-20,27H,1-6,9-12H2 |
| InChIKey | ZNNBWNWFQYDNMS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|