C19H15N5O2S — CID 168610908
N-ethyl-N-phenyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide (PubChem CID 168610908) has the molecular formula C19H15N5O2S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-ethyl-N-phenyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide.
| Compound Name | N-ethyl-N-phenyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 168610908 |
| Molecular Formula | C19H15N5O2S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-ethyl-N-phenyl-2-(1,2,2-tricyanoethenylamino)benzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C19H15N5O2S/c1-2-24(16-8-4-3-5-9-16)27(25,26)19-11-7-6-10-17(19)23-18(14-22)15(12-20)13-21/h3-11,23H,2H2,1H3 |
| InChIKey | WJQIMMISMMHEEM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|