C15H24N2O2S — CID 43454494
2-(cycloheptylamino)-N,N-dimethylbenzenesulfonamide (PubChem CID 43454494) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-(cycloheptylamino)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-(cycloheptylamino)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43454494 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(cycloheptylamino)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1NC1CCCCCC1 |
| InChI | InChI=1S/C15H24N2O2S/c1-17(2)20(18,19)15-12-8-7-11-14(15)16-13-9-5-3-4-6-10-13/h7-8,11-13,16H,3-6,9-10H2,1-2H3 |
| InChIKey | MOYSQEGMVLFOBZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |