C13H20N2 — CID 43726461
1-N-cyclopentyl-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 43726461) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-N-cyclopentyl-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 1-N-cyclopentyl-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43726461 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-N-cyclopentyl-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1ccccc1NC1CCCC1 |
| InChI | InChI=1S/C13H20N2/c1-15(2)13-10-6-5-9-12(13)14-11-7-3-4-8-11/h5-6,9-11,14H,3-4,7-8H2,1-2H3 |
| InChIKey | FLZHXIBXAMLNPN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |