C13H20N2O — CID 43726415
2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine (PubChem CID 43726415) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine.
| Compound Name | 2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43726415 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
| SMILES | CN(C)c1ccccc1NC1CCOCC1 |
| InChI | InChI=1S/C13H20N2O/c1-15(2)13-6-4-3-5-12(13)14-11-7-9-16-10-8-11/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | HGFXACXXCTUADH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |