C13H19ClN2O — CID 43739695
3-chloro-2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine (PubChem CID 43739695) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 3-chloro-2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine.
| Compound Name | 3-chloro-2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 43739695 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-chloro-2-N,2-N-dimethyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
| SMILES | CN(C)c1c(Cl)cccc1NC1CCOCC1 |
| InChI | InChI=1S/C13H19ClN2O/c1-16(2)13-11(14)4-3-5-12(13)15-10-6-8-17-9-7-10/h3-5,10,15H,6-9H2,1-2H3 |
| InChIKey | IAOYISBNPHUDMK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |