About 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine
3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine (PubChem CID 79730840) has the molecular formula C12H18ClN3
and a molecular weight of 239.75 g/mol. Its IUPAC name is 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine |
| PubChem CID | 79730840 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine |
| SMILES | CN(C)c1c(Cl)cccc1NC1CCNC1 |
| InChI | InChI=1S/C12H18ClN3/c1-16(2)12-10(13)4-3-5-11(12)15-9-6-7-14-8-9/h3-5,9,14-15H,6-8H2,1-2H3 |
| InChIKey | LAJHDQGVLRXJGX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine?
The IUPAC name of 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine (CID 79730840) is 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine.
What is the SMILES notation for 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine?
The canonical SMILES for 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine is CN(C)c1c(Cl)cccc1NC1CCNC1.
What is the InChIKey of 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine?
The InChIKey is LAJHDQGVLRXJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18ClN3/c1-16(2)12-10(13)4-3-5-11(12)15-9-6-7-14-8-9/h3-5,9,14-15H,6-8H2,1-2H3.
What are the key properties of 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine?
3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine has a molecular weight of 239.75 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-N,2-N-dimethyl-1-N-pyrrolidin-3-ylbenzene-1,2-diamine is sourced from PubChem (CID 79730840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).