About 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine
3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine (PubChem CID 65086873) has the molecular formula C18H29ClN2
and a molecular weight of 308.90 g/mol. Its IUPAC name is 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine |
| PubChem CID | 65086873 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine |
| SMILES | CCCC1CCCC(Nc2cccc(Cl)c2N(C)C)CC1 |
| InChI | InChI=1S/C18H29ClN2/c1-4-7-14-8-5-9-15(13-12-14)20-17-11-6-10-16(19)18(17)21(2)3/h6,10-11,14-15,20H,4-5,7-9,12-13H2,1-3H3 |
| InChIKey | VEOYYZHPDXJTDJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine?
The IUPAC name of 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine (CID 65086873) is 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine.
What is the SMILES notation for 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine?
The canonical SMILES for 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine is CCCC1CCCC(Nc2cccc(Cl)c2N(C)C)CC1.
What is the InChIKey of 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine?
The InChIKey is VEOYYZHPDXJTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29ClN2/c1-4-7-14-8-5-9-15(13-12-14)20-17-11-6-10-16(19)18(17)21(2)3/h6,10-11,14-15,20H,4-5,7-9,12-13H2,1-3H3.
What are the key properties of 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine?
3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine has a molecular weight of 308.90 g/mol, XLogP of 5.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-N,2-N-dimethyl-1-N-(4-propylcycloheptyl)benzene-1,2-diamine is sourced from PubChem (CID 65086873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).