C19H26N2 — CID 65086322
N-(4-propylcycloheptyl)isoquinolin-5-amine (PubChem CID 65086322) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(4-propylcycloheptyl)isoquinolin-5-amine.
| Compound Name | N-(4-propylcycloheptyl)isoquinolin-5-amine |
|---|---|
| PubChem CID | 65086322 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-(4-propylcycloheptyl)isoquinolin-5-amine |
| SMILES | CCCC1CCCC(Nc2cccc3cnccc23)CC1 |
| InChI | InChI=1S/C19H26N2/c1-2-5-15-6-3-8-17(11-10-15)21-19-9-4-7-16-14-20-13-12-18(16)19/h4,7,9,12-15,17,21H,2-3,5-6,8,10-11H2,1H3 |
| InChIKey | HYZAVVKEWGKGKN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |