C19H23N3O2 — CID 95775673
N-[(1R,3R)-3-ethylcyclohexyl]-N'-isoquinolin-5-yloxamide (PubChem CID 95775673) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[(1R,3R)-3-ethylcyclohexyl]-N'-isoquinolin-5-yloxamide.
| Compound Name | N-[(1R,3R)-3-ethylcyclohexyl]-N'-isoquinolin-5-yloxamide |
|---|---|
| PubChem CID | 95775673 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[(1R,3R)-3-ethylcyclohexyl]-N'-isoquinolin-5-yloxamide |
| SMILES | CC[C@@H]1CCC[C@@H](NC(=O)C(=O)Nc2cccc3cnccc23)C1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-13-5-3-7-15(11-13)21-18(23)19(24)22-17-8-4-6-14-12-20-10-9-16(14)17/h4,6,8-10,12-13,15H,2-3,5,7,11H2,1H3,(H,21,23)(H,22,24)/t13-,15-/m1/s1 |
| InChIKey | ASGXZRSWGNCIDQ-UKRRQHHQSA-N |
| XLogP | 3.26 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|